C17H24O5 — CID 500882
methyl (1S,4aS,5R,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 500882) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (1S,4aS,5R,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 500882 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (1S,4aS,5R,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-oxo-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C[C@H]1C(=O)C=C[C@@H]2[C@]1(C)CCC[C@]2(C)C(=O)OC |
| InChI | InChI=1S/C17H24O5/c1-16-8-5-9-17(2,15(20)22-4)13(16)7-6-12(18)11(16)10-14(19)21-3/h6-7,11,13H,5,8-10H2,1-4H3/t11-,13+,16+,17-/m0/s1 |
| InChIKey | MCDOLXWSXGKCKB-AADNMHCOSA-N |
| XLogP | 2.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |