C22H32O6 — CID 162914436
(3,9-dihydroxy-4,8,12-trimethyl-15-methylidene-14-oxo-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-11-yl) acetate (PubChem CID 162914436) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (3,9-dihydroxy-4,8,12-trimethyl-15-methylidene-14-oxo-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-11-yl) acetate.
| Compound Name | (3,9-dihydroxy-4,8,12-trimethyl-15-methylidene-14-oxo-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-11-yl) acetate |
|---|---|
| PubChem CID | 162914436 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (3,9-dihydroxy-4,8,12-trimethyl-15-methylidene-14-oxo-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-11-yl) acetate |
| SMILES | C=C1C(=O)OC2(C)CCC1CC(O)C(C)=CCC=C(C)C(O)CC2OC(C)=O |
| InChI | InChI=1S/C22H32O6/c1-13-7-6-8-14(2)19(25)12-20(27-16(4)23)22(5)10-9-17(11-18(13)24)15(3)21(26)28-22/h7-8,17-20,24-25H,3,6,9-12H2,1-2,4-5H3 |
| InChIKey | XXUJTWRIQFZTRB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|