C20H30O4 — CID 162951963
(1S,3R,4E,7Z,11R,12S)-3,11-dihydroxy-4,8,12-trimethyl-15-methylidene-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-14-one (PubChem CID 162951963) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,3R,4E,7Z,11R,12S)-3,11-dihydroxy-4,8,12-trimethyl-15-methylidene-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-14-one.
| Compound Name | (1S,3R,4E,7Z,11R,12S)-3,11-dihydroxy-4,8,12-trimethyl-15-methylidene-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-14-one |
|---|---|
| PubChem CID | 162951963 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,3R,4E,7Z,11R,12S)-3,11-dihydroxy-4,8,12-trimethyl-15-methylidene-13-oxabicyclo[10.3.2]heptadeca-4,7-dien-14-one |
| SMILES | C=C1C(=O)O[C@@]2(C)CC[C@H]1C[C@@H](O)/C(C)=C/C/C=C(/C)CC[C@H]2O |
| InChI | InChI=1S/C20H30O4/c1-13-6-5-7-14(2)17(21)12-16-10-11-20(4,18(22)9-8-13)24-19(23)15(16)3/h6-7,16-18,21-22H,3,5,8-12H2,1-2,4H3/b13-6-,14-7+/t16-,17+,18+,20-/m0/s1 |
| InChIKey | OASCGMGKXPPAEW-WGNSMCFCSA-N |
| XLogP | 3.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|