C20H34O5 — CID 163001134
(1S,3R,4R,7E,11R,12S,15S)-3,4,11-trihydroxy-4,8,12,15-tetramethyl-13-oxabicyclo[10.3.2]heptadec-7-en-14-one (PubChem CID 163001134) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1S,3R,4R,7E,11R,12S,15S)-3,4,11-trihydroxy-4,8,12,15-tetramethyl-13-oxabicyclo[10.3.2]heptadec-7-en-14-one.
| Compound Name | (1S,3R,4R,7E,11R,12S,15S)-3,4,11-trihydroxy-4,8,12,15-tetramethyl-13-oxabicyclo[10.3.2]heptadec-7-en-14-one |
|---|---|
| PubChem CID | 163001134 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (1S,3R,4R,7E,11R,12S,15S)-3,4,11-trihydroxy-4,8,12,15-tetramethyl-13-oxabicyclo[10.3.2]heptadec-7-en-14-one |
| SMILES | C/C1=C\CC[C@@](C)(O)[C@H](O)C[C@@H]2CC[C@](C)(OC(=O)[C@H]2C)[C@H](O)CC1 |
| InChI | InChI=1S/C20H34O5/c1-13-6-5-10-19(3,24)17(22)12-15-9-11-20(4,16(21)8-7-13)25-18(23)14(15)2/h6,14-17,21-22,24H,5,7-12H2,1-4H3/b13-6+/t14-,15-,16+,17+,19+,20-/m0/s1 |
| InChIKey | JYRNLNBXLZDLIM-GWGBSKBXSA-N |
| XLogP | 2.72 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|