C18H28O3 — CID 162915768
(5S,8S,9R,10S,11R,13S,14R,16S)-11,16-dihydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 162915768) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (5S,8S,9R,10S,11R,13S,14R,16S)-11,16-dihydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8S,9R,10S,11R,13S,14R,16S)-11,16-dihydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162915768 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (5S,8S,9R,10S,11R,13S,14R,16S)-11,16-dihydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12C[C@@H](O)C[C@@H]1[C@@H]1CC[C@H]3CC(=O)CC[C@@H]3[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C18H28O3/c1-18-8-12(20)7-15(18)14-4-2-10-6-11(19)3-5-13(10)17(14)16(21)9-18/h10,12-17,20-21H,2-9H2,1H3/t10-,12-,13-,14-,15+,16+,17+,18-/m0/s1 |
| InChIKey | CXNZCFVPMJZWJF-QALPSOFBSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |