C20H30O2 — CID 142146851
(1R,2R,4R,6R,7S,10R,11S)-6-(hydroxymethyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-one (PubChem CID 142146851) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2R,4R,6R,7S,10R,11S)-6-(hydroxymethyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-one.
| Compound Name | (1R,2R,4R,6R,7S,10R,11S)-6-(hydroxymethyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-one |
|---|---|
| PubChem CID | 142146851 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2R,4R,6R,7S,10R,11S)-6-(hydroxymethyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)CC[C@@H]43)[C@H]1C[C@@H]1C[C@@]12CO |
| InChI | InChI=1S/C20H30O2/c1-19-7-6-16-15-5-3-14(22)8-12(15)2-4-17(16)18(19)9-13-10-20(13,19)11-21/h12-13,15-18,21H,2-11H2,1H3/t12?,13-,15+,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | JYDYAZCLXILSNY-RKHIRLPOSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |