C30H48O4 — CID 162915898
8-(hydroxymethyl)-16-(7-hydroxy-6-methylhept-5-en-2-yl)-8,13,17-trimethyl-7-oxapentacyclo[10.7.0.01,3.03,9.013,17]nonadecan-6-one (PubChem CID 162915898) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 8-(hydroxymethyl)-16-(7-hydroxy-6-methylhept-5-en-2-yl)-8,13,17-trimethyl-7-oxapentacyclo[10.7.0.01,3.03,9.013,17]nonadecan-6-one.
| Compound Name | 8-(hydroxymethyl)-16-(7-hydroxy-6-methylhept-5-en-2-yl)-8,13,17-trimethyl-7-oxapentacyclo[10.7.0.01,3.03,9.013,17]nonadecan-6-one |
|---|---|
| PubChem CID | 162915898 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 8-(hydroxymethyl)-16-(7-hydroxy-6-methylhept-5-en-2-yl)-8,13,17-trimethyl-7-oxapentacyclo[10.7.0.01,3.03,9.013,17]nonadecan-6-one |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3CCC4C(C)(CO)OC(=O)CCC45CC35CCC12C)CO |
| InChI | InChI=1S/C30H48O4/c1-20(17-31)7-6-8-21(2)22-11-13-27(4)23-9-10-24-28(5,19-32)34-25(33)12-14-29(24)18-30(23,29)16-15-26(22,27)3/h7,21-24,31-32H,6,8-19H2,1-5H3 |
| InChIKey | MHCFHQXWIRLEMO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|