C31H48O3 — CID 162998984
methyl 2-methyl-6-(7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-2-enoate (PubChem CID 162998984) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is methyl 2-methyl-6-(7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-2-enoate.
| Compound Name | methyl 2-methyl-6-(7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-2-enoate |
|---|---|
| PubChem CID | 162998984 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | methyl 2-methyl-6-(7,7,12,16-tetramethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)hept-2-enoate |
| SMILES | COC(=O)C(C)=CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(=O)CCC45CC35CCC12C |
| InChI | InChI=1S/C31H48O3/c1-20(9-8-10-21(2)26(33)34-7)22-13-15-29(6)24-12-11-23-27(3,4)25(32)14-16-30(23)19-31(24,30)18-17-28(22,29)5/h10,20,22-24H,8-9,11-19H2,1-7H3 |
| InChIKey | WYGNOIJKFWFCPY-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|