C19H22O7 — CID 162917250
[(1S,2S,3S,4R,8S,9S,10R,12R)-3-hydroxy-2-methyl-7,11-dimethylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-9-yl] 2-methylprop-2-enoate (PubChem CID 162917250) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(1S,2S,3S,4R,8S,9S,10R,12R)-3-hydroxy-2-methyl-7,11-dimethylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-9-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,2S,3S,4R,8S,9S,10R,12R)-3-hydroxy-2-methyl-7,11-dimethylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162917250 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(1S,2S,3S,4R,8S,9S,10R,12R)-3-hydroxy-2-methyl-7,11-dimethylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H]1[C@@H]2C(=C)C(=O)O[C@H]2[C@@H](O)[C@]2(C)[C@@H]1C(=C)[C@@H]1OC[C@H]2O1 |
| InChI | InChI=1S/C19H22O7/c1-7(2)16(21)25-13-11-8(3)17(22)26-14(11)15(20)19(5)10-6-23-18(24-10)9(4)12(13)19/h10-15,18,20H,1,3-4,6H2,2,5H3/t10-,11+,12-,13-,14-,15-,18-,19+/m1/s1 |
| InChIKey | VLSXPNVLJFPZEF-MNASWXRMSA-N |
| XLogP | 0.88 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|