C24H32O8 — CID 23583542
[(1R,2S,3S,6S,7R,8S,9S,13S)-3,6-dihydroxy-2,6-dimethyl-10-methylidene-8-(2-methylprop-2-enoyloxy)-11-oxo-12-oxatricyclo[7.3.1.02,7]tridecan-13-yl] (E)-2-methylbut-2-enoate (PubChem CID 23583542) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2S,3S,6S,7R,8S,9S,13S)-3,6-dihydroxy-2,6-dimethyl-10-methylidene-8-(2-methylprop-2-enoyloxy)-11-oxo-12-oxatricyclo[7.3.1.02,7]tridecan-13-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,3S,6S,7R,8S,9S,13S)-3,6-dihydroxy-2,6-dimethyl-10-methylidene-8-(2-methylprop-2-enoyloxy)-11-oxo-12-oxatricyclo[7.3.1.02,7]tridecan-13-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 23583542 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(1R,2S,3S,6S,7R,8S,9S,13S)-3,6-dihydroxy-2,6-dimethyl-10-methylidene-8-(2-methylprop-2-enoyloxy)-11-oxo-12-oxatricyclo[7.3.1.02,7]tridecan-13-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@@H]2C(=C)C(=O)O[C@@H]([C@H]2OC(=O)/C(C)=C/C)[C@]2(C)[C@@H](O)CC[C@](C)(O)[C@@H]12 |
| InChI | InChI=1S/C24H32O8/c1-8-12(4)21(27)31-17-15-13(5)22(28)32-19(17)24(7)14(25)9-10-23(6,29)18(24)16(15)30-20(26)11(2)3/h8,14-19,25,29H,2,5,9-10H2,1,3-4,6-7H3/b12-8+/t14-,15-,16-,17-,18+,19-,23-,24+/m0/s1 |
| InChIKey | YLVUHLJWIKJTMB-MDOHBNOUSA-N |
| XLogP | 1.99 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|