C27H32O10 — CID 162917430
methyl 3-[(1R,2R,4S,7S,8S,12R,13R,17S)-7-(furan-3-yl)-13,17-dihydroxy-1,8,12,15,15-pentamethyl-5,14-dioxo-3,6,16-trioxapentacyclo[9.6.0.02,4.02,8.013,17]heptadecan-12-yl]prop-2-enoate (PubChem CID 162917430) has the molecular formula C27H32O10 and a molecular weight of 516.54 g/mol. Its IUPAC name is methyl 3-[(1R,2R,4S,7S,8S,12R,13R,17S)-7-(furan-3-yl)-13,17-dihydroxy-1,8,12,15,15-pentamethyl-5,14-dioxo-3,6,16-trioxapentacyclo[9.6.0.02,4.02,8.013,17]heptadecan-12-yl]prop-2-enoate.
| Compound Name | methyl 3-[(1R,2R,4S,7S,8S,12R,13R,17S)-7-(furan-3-yl)-13,17-dihydroxy-1,8,12,15,15-pentamethyl-5,14-dioxo-3,6,16-trioxapentacyclo[9.6.0.02,4.02,8.013,17]heptadecan-12-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162917430 |
| Molecular Formula | C27H32O10 |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl 3-[(1R,2R,4S,7S,8S,12R,13R,17S)-7-(furan-3-yl)-13,17-dihydroxy-1,8,12,15,15-pentamethyl-5,14-dioxo-3,6,16-trioxapentacyclo[9.6.0.02,4.02,8.013,17]heptadecan-12-yl]prop-2-enoate |
| SMILES | COC(=O)C=C[C@]1(C)C2CC[C@@]3(C)[C@H](c4ccoc4)OC(=O)[C@H]4O[C@]43[C@]2(C)[C@]2(O)OC(C)(C)C(=O)[C@@]21O |
| InChI | InChI=1S/C27H32O10/c1-21(2)20(30)25(31)22(3,11-8-16(28)33-6)15-7-10-23(4)17(14-9-12-34-13-14)35-19(29)18-26(23,36-18)24(15,5)27(25,32)37-21/h8-9,11-13,15,17-18,31-32H,7,10H2,1-6H3/t15?,17-,18+,22+,23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | DYNIRWNERRSOEV-XFPOCIRDSA-N |
| XLogP | 1.98 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|