C27H34N2O4 — CID 162917797
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide (PubChem CID 162917797) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
|---|---|
| PubChem CID | 162917797 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(3,5,9-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)propanamide |
| SMILES | Cc1coc2c(C)c3oc(=O)c(CCC(=O)NCC4CCCN5CCCCC45)c(C)c3cc12 |
| InChI | InChI=1S/C27H34N2O4/c1-16-15-32-25-18(3)26-22(13-21(16)25)17(2)20(27(31)33-26)9-10-24(30)28-14-19-7-6-12-29-11-5-4-8-23(19)29/h13,15,19,23H,4-12,14H2,1-3H3,(H,28,30) |
| InChIKey | FUUUQBVLQWCMLJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|