C25H32O4 — CID 162917912
(3Z,5R)-3-[(4E,8E,10Z)-4,8-dimethyl-11-(5-oxo-2H-furan-3-yl)undeca-4,8,10-trienylidene]-5-(2-methylprop-1-enyl)oxolan-2-one (PubChem CID 162917912) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (3Z,5R)-3-[(4E,8E,10Z)-4,8-dimethyl-11-(5-oxo-2H-furan-3-yl)undeca-4,8,10-trienylidene]-5-(2-methylprop-1-enyl)oxolan-2-one.
| Compound Name | (3Z,5R)-3-[(4E,8E,10Z)-4,8-dimethyl-11-(5-oxo-2H-furan-3-yl)undeca-4,8,10-trienylidene]-5-(2-methylprop-1-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 162917912 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3Z,5R)-3-[(4E,8E,10Z)-4,8-dimethyl-11-(5-oxo-2H-furan-3-yl)undeca-4,8,10-trienylidene]-5-(2-methylprop-1-enyl)oxolan-2-one |
| SMILES | CC(C)=C[C@H]1C/C(=C/CC/C(C)=C/CC/C(C)=C/C=C\C2=CC(=O)OC2)C(=O)O1 |
| InChI | InChI=1S/C25H32O4/c1-18(2)14-23-16-22(25(27)29-23)13-7-11-20(4)9-5-8-19(3)10-6-12-21-15-24(26)28-17-21/h6,9-10,12-15,23H,5,7-8,11,16-17H2,1-4H3/b12-6-,19-10+,20-9+,22-13-/t23-/m0/s1 |
| InChIKey | COKIPKAOLSMHOF-IURVUGLGSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|