C13H22O3 — CID 162918265
7-ethyl-10-hydroxyundec-7-ene-3,6-dione (PubChem CID 162918265) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 7-ethyl-10-hydroxyundec-7-ene-3,6-dione.
| Compound Name | 7-ethyl-10-hydroxyundec-7-ene-3,6-dione |
|---|---|
| PubChem CID | 162918265 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 7-ethyl-10-hydroxyundec-7-ene-3,6-dione |
| SMILES | CCC(=O)CCC(=O)C(=CCC(C)O)CC |
| InChI | InChI=1S/C13H22O3/c1-4-11(7-6-10(3)14)13(16)9-8-12(15)5-2/h7,10,14H,4-6,8-9H2,1-3H3 |
| InChIKey | ORXJSCDQUTXZPA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|