C22H32O5 — CID 162920019
(Z)-7-[(1R,2S)-2-[(Z,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 162920019) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[(Z,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S)-2-[(Z,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 162920019 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[(Z,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](/C=C\[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C22H32O5/c1-3-4-7-10-19(27-17(2)23)15-13-18-14-16-21(24)20(18)11-8-5-6-9-12-22(25)26/h5,8,13-16,18-20H,3-4,6-7,9-12H2,1-2H3,(H,25,26)/b8-5-,15-13-/t18-,19+,20+/m0/s1 |
| InChIKey | JKOMICWLAGHZOC-TUAKKSKPSA-N |
| XLogP | 4.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|