C23H33IO6 — CID 10256517
methyl (Z,7S)-7-acetyloxy-7-[(1R,2S)-2-hydroxy-4-iodo-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 10256517) has the molecular formula C23H33IO6 and a molecular weight of 532.42 g/mol. Its IUPAC name is methyl (Z,7S)-7-acetyloxy-7-[(1R,2S)-2-hydroxy-4-iodo-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z,7S)-7-acetyloxy-7-[(1R,2S)-2-hydroxy-4-iodo-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 10256517 |
| Molecular Formula | C23H33IO6 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | methyl (Z,7S)-7-acetyloxy-7-[(1R,2S)-2-hydroxy-4-iodo-2-[(Z)-oct-2-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCC/C=C\C[C@@]1(O)C=C(I)C(=O)[C@@H]1[C@H](/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C23H33IO6/c1-4-5-6-7-8-12-15-23(28)16-18(24)22(27)21(23)19(30-17(2)25)13-10-9-11-14-20(26)29-3/h8,10,12-13,16,19,21,28H,4-7,9,11,14-15H2,1-3H3/b12-8-,13-10-/t19-,21-,23+/m0/s1 |
| InChIKey | PHLDSBOKGDMUEL-WAALSUGPSA-N |
| XLogP | 4.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|