C23H36O5 — CID 156679709
methyl 4-[3-[(2Z,5Z,8Z)-1-acetyloxytetradeca-2,5,8-trienyl]oxiran-2-yl]butanoate (PubChem CID 156679709) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl 4-[3-[(2Z,5Z,8Z)-1-acetyloxytetradeca-2,5,8-trienyl]oxiran-2-yl]butanoate.
| Compound Name | methyl 4-[3-[(2Z,5Z,8Z)-1-acetyloxytetradeca-2,5,8-trienyl]oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 156679709 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methyl 4-[3-[(2Z,5Z,8Z)-1-acetyloxytetradeca-2,5,8-trienyl]oxiran-2-yl]butanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C(OC(C)=O)C1OC1CCCC(=O)OC |
| InChI | InChI=1S/C23H36O5/c1-4-5-6-7-8-9-10-11-12-13-14-16-20(27-19(2)24)23-21(28-23)17-15-18-22(25)26-3/h8-9,11-12,14,16,20-21,23H,4-7,10,13,15,17-18H2,1-3H3/b9-8-,12-11-,16-14- |
| InChIKey | JBZVCSLJUDHTKF-WURHYBAGSA-N |
| XLogP | 5.06 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|