C25H38O6 — CID 14732189
methyl (5Z,8Z,10E,12R,13S,14Z)-12,13-diacetyloxyicosa-5,8,10,14-tetraenoate (PubChem CID 14732189) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is methyl (5Z,8Z,10E,12R,13S,14Z)-12,13-diacetyloxyicosa-5,8,10,14-tetraenoate.
| Compound Name | methyl (5Z,8Z,10E,12R,13S,14Z)-12,13-diacetyloxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 14732189 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | methyl (5Z,8Z,10E,12R,13S,14Z)-12,13-diacetyloxyicosa-5,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\[C@H](OC(C)=O)[C@@H](/C=C/C=C\C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C25H38O6/c1-5-6-7-12-15-18-23(30-21(2)26)24(31-22(3)27)19-16-13-10-8-9-11-14-17-20-25(28)29-4/h9-11,13,15-16,18-19,23-24H,5-8,12,14,17,20H2,1-4H3/b11-9-,13-10-,18-15-,19-16+/t23-,24+/m0/s1 |
| InChIKey | WRNRLBDOKZGVIK-PHEMPBAASA-N |
| XLogP | 5.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|