C21H33ClO3 — CID 134900210
methyl (5R,6S,7E,9E,11Z,14Z)-5-chloro-6-hydroxyicosa-7,9,11,14-tetraenoate (PubChem CID 134900210) has the molecular formula C21H33ClO3 and a molecular weight of 368.95 g/mol. Its IUPAC name is methyl (5R,6S,7E,9E,11Z,14Z)-5-chloro-6-hydroxyicosa-7,9,11,14-tetraenoate.
| Compound Name | methyl (5R,6S,7E,9E,11Z,14Z)-5-chloro-6-hydroxyicosa-7,9,11,14-tetraenoate |
|---|---|
| PubChem CID | 134900210 |
| Molecular Formula | C21H33ClO3 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl (5R,6S,7E,9E,11Z,14Z)-5-chloro-6-hydroxyicosa-7,9,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H](O)[C@H](Cl)CCCC(=O)OC |
| InChI | InChI=1S/C21H33ClO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-20(23)19(22)16-15-18-21(24)25-2/h7-8,10-14,17,19-20,23H,3-6,9,15-16,18H2,1-2H3/b8-7-,11-10-,13-12+,17-14+/t19-,20+/m1/s1 |
| InChIKey | LVPIMDHZEVAOTL-STBGARPZSA-N |
| XLogP | 5.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|