C25H41NO5S — CID 10671952
methyl (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoate (PubChem CID 10671952) has the molecular formula C25H41NO5S and a molecular weight of 467.67 g/mol. Its IUPAC name is methyl (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoate.
| Compound Name | methyl (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoate |
|---|---|
| PubChem CID | 10671952 |
| Molecular Formula | C25H41NO5S |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | methyl (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)OC)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C25H41NO5S/c1-4-5-6-7-8-9-10-11-12-13-14-15-18-23(32-20-21(26)25(29)31-3)22(27)17-16-19-24(28)30-2/h8-9,11-15,18,21-23,27H,4-7,10,16-17,19-20,26H2,1-3H3/b9-8-,12-11-,14-13+,18-15+/t21-,22-,23+/m0/s1 |
| InChIKey | NKYZUFTVQVOYQO-LLZWLTTKSA-N |
| XLogP | 4.49 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|