C10H10O6 — CID 162920814
2-(5,6-dioxo-2,3,4,8-tetrahydrofuro[3,4-b]oxepin-8-yl)acetic acid (PubChem CID 162920814) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 2-(5,6-dioxo-2,3,4,8-tetrahydrofuro[3,4-b]oxepin-8-yl)acetic acid.
| Compound Name | 2-(5,6-dioxo-2,3,4,8-tetrahydrofuro[3,4-b]oxepin-8-yl)acetic acid |
|---|---|
| PubChem CID | 162920814 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(5,6-dioxo-2,3,4,8-tetrahydrofuro[3,4-b]oxepin-8-yl)acetic acid |
| SMILES | O=C(O)CC1OC(=O)C2=C1OCCCC2=O |
| InChI | InChI=1S/C10H10O6/c11-5-2-1-3-15-9-6(4-7(12)13)16-10(14)8(5)9/h6H,1-4H2,(H,12,13) |
| InChIKey | STASDEBCLZPNAY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|