C11H14O4 — CID 162984061
(2S,8R)-2-ethyl-8-methyl-2,3,4,8-tetrahydrofuro[3,4-b]oxepine-5,6-dione (PubChem CID 162984061) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2S,8R)-2-ethyl-8-methyl-2,3,4,8-tetrahydrofuro[3,4-b]oxepine-5,6-dione.
| Compound Name | (2S,8R)-2-ethyl-8-methyl-2,3,4,8-tetrahydrofuro[3,4-b]oxepine-5,6-dione |
|---|---|
| PubChem CID | 162984061 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2S,8R)-2-ethyl-8-methyl-2,3,4,8-tetrahydrofuro[3,4-b]oxepine-5,6-dione |
| SMILES | CC[C@H]1CCC(=O)C2=C(O1)[C@@H](C)OC2=O |
| InChI | InChI=1S/C11H14O4/c1-3-7-4-5-8(12)9-10(15-7)6(2)14-11(9)13/h6-7H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | WZCINOZWJGKJQI-RQJHMYQMSA-N |
| XLogP | 1.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|