C15H26O4 — CID 162921211
4,8-dihydroxy-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one (PubChem CID 162921211) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4,8-dihydroxy-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one.
| Compound Name | 4,8-dihydroxy-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 162921211 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4,8-dihydroxy-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-one |
| SMILES | CC1C(=O)CC2C(C1O)C(C(C)(C)O)CCC2(C)O |
| InChI | InChI=1S/C15H26O4/c1-8-11(16)7-10-12(13(8)17)9(14(2,3)18)5-6-15(10,4)19/h8-10,12-13,17-19H,5-7H2,1-4H3 |
| InChIKey | ZASMGHSREUVBCZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |