C49H80O2 — CID 162921830
[17-(5-ethyl-6-methylhept-5-en-2-yl)-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] octadeca-9,12,15-trienoate (PubChem CID 162921830) has the molecular formula C49H80O2 and a molecular weight of 701.18 g/mol. Its IUPAC name is [17-(5-ethyl-6-methylhept-5-en-2-yl)-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] octadeca-9,12,15-trienoate.
| Compound Name | [17-(5-ethyl-6-methylhept-5-en-2-yl)-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 162921830 |
| Molecular Formula | C49H80O2 |
| Molecular Weight | 701.18 g/mol |
| Exact Mass | 700.62 |
| IUPAC Name | [17-(5-ethyl-6-methylhept-5-en-2-yl)-4,10,13,14-tetramethyl-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] octadeca-9,12,15-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OC1CCC2(C)C3=C(CCC2C1C)C1(C)CCC(C(C)CCC(CC)=C(C)C)C1(C)CC3 |
| InChI | InChI=1S/C49H80O2/c1-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-46(50)51-45-33-34-47(7)42(39(45)6)29-30-44-43(47)32-36-48(8)41(31-35-49(44,48)9)38(5)27-28-40(11-2)37(3)4/h12-13,15-16,18-19,38-39,41-42,45H,10-11,14,17,20-36H2,1-9H3 |
| InChIKey | UQLDWHRNVZMGNR-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.18 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|