C30H50O5 — CID 162925520
17-(5,6-dihydroxy-6-methylheptan-2-yl)-3,16-dihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one (PubChem CID 162925520) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is 17-(5,6-dihydroxy-6-methylheptan-2-yl)-3,16-dihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | 17-(5,6-dihydroxy-6-methylheptan-2-yl)-3,16-dihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 162925520 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | 17-(5,6-dihydroxy-6-methylheptan-2-yl)-3,16-dihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC(CCC(O)C(C)(C)O)C1C(O)CC2(C)C3CC=C4C(CCC(O)C4(C)C)C3(C)C(=O)CC12C |
| InChI | InChI=1S/C30H50O5/c1-17(9-13-23(33)27(4,5)35)25-20(31)15-28(6)21-12-10-18-19(11-14-22(32)26(18,2)3)30(21,8)24(34)16-29(25,28)7/h10,17,19-23,25,31-33,35H,9,11-16H2,1-8H3 |
| InChIKey | QXNQZDXCXYSMPX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|