C32H48O6 — CID 162927339
dimethyl (2R,3R,4R,4aS,6aR,6bS,8aS,14aR,14bR)-2,3-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicene-4,8a-dicarboxylate (PubChem CID 162927339) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is dimethyl (2R,3R,4R,4aS,6aR,6bS,8aS,14aR,14bR)-2,3-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicene-4,8a-dicarboxylate.
| Compound Name | dimethyl (2R,3R,4R,4aS,6aR,6bS,8aS,14aR,14bR)-2,3-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicene-4,8a-dicarboxylate |
|---|---|
| PubChem CID | 162927339 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | dimethyl (2R,3R,4R,4aS,6aR,6bS,8aS,14aR,14bR)-2,3-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,14,14a-dodecahydropicene-4,8a-dicarboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C=C1C1=CC[C@@H]3[C@@]4(C)C[C@@H](O)[C@H](O)[C@](C)(C(=O)OC)[C@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H48O6/c1-27(2)13-15-32(26(36)38-8)16-14-29(4)19(20(32)17-27)9-10-22-28(3)18-21(33)24(34)31(6,25(35)37-7)23(28)11-12-30(22,29)5/h9,17,21-24,33-34H,10-16,18H2,1-8H3/t21-,22-,23+,24+,28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | ICEDCLBIBFDMQN-ABMSEWHWSA-N |
| XLogP | 5.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |