C32H50O7 — CID 163057825
dimethyl 2,3,11-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate (PubChem CID 163057825) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is dimethyl 2,3,11-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate.
| Compound Name | dimethyl 2,3,11-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate |
|---|---|
| PubChem CID | 163057825 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | dimethyl 2,3,11-trihydroxy-4,6a,6b,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylate |
| SMILES | COC(=O)C12CCC(C)(O)C(C)C1C1=CCC3C4(C)CC(O)C(O)C(C)(C(=O)OC)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C32H50O7/c1-18-23-19-9-10-21-27(2)17-20(33)24(34)31(6,25(35)38-7)22(27)11-12-29(21,4)28(19,3)13-15-32(23,26(36)39-8)16-14-30(18,5)37/h9,18,20-24,33-34,37H,10-17H2,1-8H3 |
| InChIKey | XTQOXSXRSANKIJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|