C14H20O — CID 162927783
(7R,8E,12E)-tetradeca-1,8,12-trien-10-yn-7-ol (PubChem CID 162927783) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (7R,8E,12E)-tetradeca-1,8,12-trien-10-yn-7-ol.
| Compound Name | (7R,8E,12E)-tetradeca-1,8,12-trien-10-yn-7-ol |
|---|---|
| PubChem CID | 162927783 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (7R,8E,12E)-tetradeca-1,8,12-trien-10-yn-7-ol |
| SMILES | C=CCCCC[C@@H](O)/C=C/C#C/C=C/C |
| InChI | InChI=1S/C14H20O/c1-3-5-7-9-11-13-14(15)12-10-8-6-4-2/h3-5,11,13-15H,2,6,8,10,12H2,1H3/b5-3+,13-11+/t14-/m1/s1 |
| InChIKey | FDFGZMGALLFLNJ-DJHBACGWSA-N |
| XLogP | 3.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|