C26H41NO2 — CID 162928076
(1S,2R,6S,9S,10S,11S,14R,15R,20S,23R,24R)-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-ene-10,20-diol (PubChem CID 162928076) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (1S,2R,6S,9S,10S,11S,14R,15R,20S,23R,24R)-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-ene-10,20-diol.
| Compound Name | (1S,2R,6S,9S,10S,11S,14R,15R,20S,23R,24R)-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-ene-10,20-diol |
|---|---|
| PubChem CID | 162928076 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (1S,2R,6S,9S,10S,11S,14R,15R,20S,23R,24R)-6,23-dimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-ene-10,20-diol |
| SMILES | C[C@H]1CC[C@H]2[C@@H](O)[C@H]3CC[C@H]4[C@H](C[C@@H]5[C@@H]4CC=C4C[C@@H](O)CC[C@@]45C)[C@H]3CN2C1 |
| InChI | InChI=1S/C26H41NO2/c1-15-3-8-24-25(29)20-7-6-18-19-5-4-16-11-17(28)9-10-26(16,2)23(19)12-21(18)22(20)14-27(24)13-15/h4,15,17-25,28-29H,3,5-14H2,1-2H3/t15-,17-,18+,19+,20-,21-,22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | VJYPILHMXGYWKP-JHKNHVMRSA-N |
| XLogP | 4.24 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|