C27H43NO — CID 162976863
(1S,2S,6S,9R,10S,11S,14S,15R,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-ol (PubChem CID 162976863) has the molecular formula C27H43NO and a molecular weight of 397.65 g/mol. Its IUPAC name is (1S,2S,6S,9R,10S,11S,14S,15R,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-ol.
| Compound Name | (1S,2S,6S,9R,10S,11S,14S,15R,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-ol |
|---|---|
| PubChem CID | 162976863 |
| Molecular Formula | C27H43NO |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | (1S,2S,6S,9R,10S,11S,14S,15R,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-17-en-20-ol |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3CC[C@@H]4[C@H](C[C@@H]5[C@@H]4CC=C4C[C@@H](O)CC[C@@]45C)[C@@H]3CN2C1 |
| InChI | InChI=1S/C27H43NO/c1-16-4-9-26-17(2)20-7-8-21-22-6-5-18-12-19(29)10-11-27(18,3)25(22)13-23(21)24(20)15-28(26)14-16/h5,16-17,19-26,29H,4,6-15H2,1-3H3/t16-,17-,19-,20+,21-,22+,23-,24+,25+,26+,27-/m0/s1 |
| InChIKey | BMMRSXNAPFQLLU-QHSHMIJLSA-N |
| XLogP | 5.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|