C14H18O10 — CID 162928915
3,5-dimethoxy-4-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzoic acid (PubChem CID 162928915) has the molecular formula C14H18O10 and a molecular weight of 346.29 g/mol. Its IUPAC name is 3,5-dimethoxy-4-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzoic acid.
| Compound Name | 3,5-dimethoxy-4-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 162928915 |
| Molecular Formula | C14H18O10 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3,5-dimethoxy-4-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1O[C@@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O10/c1-21-6-3-5(12(18)19)4-7(22-2)11(6)23-14-10(17)8(15)9(16)13(20)24-14/h3-4,8-10,13-17,20H,1-2H3,(H,18,19)/t8-,9-,10-,13-,14-/m1/s1 |
| InChIKey | OFTJCIKSBFGRPM-DRDKAZGBSA-N |
| XLogP | -1.46 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |