C18H26O13 — CID 162930745
(2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trihydroxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 162930745) has the molecular formula C18H26O13 and a molecular weight of 450.39 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trihydroxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trihydroxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162930745 |
| Molecular Formula | C18H26O13 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trihydroxyphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3cc(O)c(O)c(O)c3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26O13/c1-5-10(21)13(24)15(26)17(29-5)28-4-9-12(23)14(25)16(27)18(31-9)30-6-2-7(19)11(22)8(20)3-6/h2-3,5,9-10,12-27H,4H2,1H3/t5-,9+,10-,12+,13+,14-,15+,16+,17+,18+/m0/s1 |
| InChIKey | ORETVEOAZLWBDV-YRXVYCAWSA-N |
| XLogP | -3.17 |
| TPSA | 218.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|