C20H30O12 — CID 162997864
(2R,3R,4R,5R,6R)-2-[[(2S,3S,4R,5S,6S)-6-(3,4-dimethoxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol (PubChem CID 162997864) has the molecular formula C20H30O12 and a molecular weight of 462.45 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-[[(2S,3S,4R,5S,6S)-6-(3,4-dimethoxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6R)-2-[[(2S,3S,4R,5S,6S)-6-(3,4-dimethoxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 162997864 |
| Molecular Formula | C20H30O12 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-[[(2S,3S,4R,5S,6S)-6-(3,4-dimethoxyphenoxy)-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(O[C@@H]2O[C@@H](CO[C@@H]3O[C@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@@H](O)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C20H30O12/c1-8-13(21)15(23)17(25)19(30-8)29-7-12-14(22)16(24)18(26)20(32-12)31-9-4-5-10(27-2)11(6-9)28-3/h4-6,8,12-26H,7H2,1-3H3/t8-,12+,13+,14-,15-,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | ALPIUWBZQOROIJ-USRUMRALSA-N |
| XLogP | -2.27 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |