C33H45NO7 — CID 162930919
(11-ethyl-8,9-dihydroxy-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl) 3-phenylprop-2-enoate (PubChem CID 162930919) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is (11-ethyl-8,9-dihydroxy-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl) 3-phenylprop-2-enoate.
| Compound Name | (11-ethyl-8,9-dihydroxy-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162930919 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | (11-ethyl-8,9-dihydroxy-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl) 3-phenylprop-2-enoate |
| SMILES | CCN1CC2(C)CCC(OC)C34C5CC6C(OC)CC(O)(C5C6OC(=O)C=Cc5ccccc5)C(O)(C(OC)C23)C14 |
| InChI | InChI=1S/C33H45NO7/c1-6-34-18-30(2)15-14-23(39-4)32-21-16-20-22(38-3)17-31(36,33(37,29(32)34)28(40-5)27(30)32)25(21)26(20)41-24(35)13-12-19-10-8-7-9-11-19/h7-13,20-23,25-29,36-37H,6,14-18H2,1-5H3 |
| InChIKey | SJZWBVMZCIGKBJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|