C40H52O5 — CID 162931265
3-(hydroxymethyl)-4-[17-(hydroxymethyl)-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13-trimethylnonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-3,4-dimethylcyclopentan-1-one (PubChem CID 162931265) has the molecular formula C40H52O5 and a molecular weight of 612.85 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-[17-(hydroxymethyl)-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13-trimethylnonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-3,4-dimethylcyclopentan-1-one.
| Compound Name | 3-(hydroxymethyl)-4-[17-(hydroxymethyl)-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13-trimethylnonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-3,4-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 162931265 |
| Molecular Formula | C40H52O5 |
| Molecular Weight | 612.85 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | 3-(hydroxymethyl)-4-[17-(hydroxymethyl)-19-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-4,8,13-trimethylnonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-3,4-dimethylcyclopentan-1-one |
| SMILES | CC(C=CC=C(C)C=CC(=O)C1(C)CC(=O)CC1(C)CO)=CC=CC=C(C)C=CC=C(C#CC1=C(C)CC(O)CC1(C)C)CO |
| InChI | InChI=1S/C40H52O5/c1-29(15-11-16-31(3)19-22-37(45)40(8)26-35(44)25-39(40,7)28-42)13-9-10-14-30(2)17-12-18-33(27-41)20-21-36-32(4)23-34(43)24-38(36,5)6/h9-19,22,34,41-43H,23-28H2,1-8H3 |
| InChIKey | BMDUTGJURITIAP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|