C40H50O9S — CID 163124654
2-[17-(hydroxymethyl)-4,8,13-trimethyl-19-(2,6,6-trimethyl-4-sulfooxycyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-1,2-dimethyl-4-oxocyclopentane-1-carboxylic acid (PubChem CID 163124654) has the molecular formula C40H50O9S and a molecular weight of 706.90 g/mol. Its IUPAC name is 2-[17-(hydroxymethyl)-4,8,13-trimethyl-19-(2,6,6-trimethyl-4-sulfooxycyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-1,2-dimethyl-4-oxocyclopentane-1-carboxylic acid.
| Compound Name | 2-[17-(hydroxymethyl)-4,8,13-trimethyl-19-(2,6,6-trimethyl-4-sulfooxycyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-1,2-dimethyl-4-oxocyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 163124654 |
| Molecular Formula | C40H50O9S |
| Molecular Weight | 706.90 g/mol |
| Exact Mass | 706.32 |
| IUPAC Name | 2-[17-(hydroxymethyl)-4,8,13-trimethyl-19-(2,6,6-trimethyl-4-sulfooxycyclohexen-1-yl)nonadeca-2,4,6,8,10,12,14,16-octaen-18-ynoyl]-1,2-dimethyl-4-oxocyclopentane-1-carboxylic acid |
| SMILES | CC(C=CC=C(C)C=CC(=O)C1(C)CC(=O)CC1(C)C(=O)O)=CC=CC=C(C)C=CC=C(C#CC1=C(C)CC(OS(=O)(=O)O)CC1(C)C)CO |
| InChI | InChI=1S/C40H50O9S/c1-28(15-11-16-30(3)19-22-36(43)39(7)24-33(42)25-40(39,8)37(44)45)13-9-10-14-29(2)17-12-18-32(27-41)20-21-35-31(4)23-34(26-38(35,5)6)49-50(46,47)48/h9-19,22,34,41H,23-27H2,1-8H3,(H,44,45)(H,46,47,48) |
| InChIKey | CUWCDZGFISCKLX-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.90 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|