C42H56O5 — CID 163087370
[(1R)-4-[18-[(2S,3R,5R)-2,3-dimethyl-5-(2-oxopropyl)oxolan-2-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-3,5,7,9,11,13,15-heptaen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate (PubChem CID 163087370) has the molecular formula C42H56O5 and a molecular weight of 640.91 g/mol. Its IUPAC name is [(1R)-4-[18-[(2S,3R,5R)-2,3-dimethyl-5-(2-oxopropyl)oxolan-2-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-3,5,7,9,11,13,15-heptaen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R)-4-[18-[(2S,3R,5R)-2,3-dimethyl-5-(2-oxopropyl)oxolan-2-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-3,5,7,9,11,13,15-heptaen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 163087370 |
| Molecular Formula | C42H56O5 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.41 |
| IUPAC Name | [(1R)-4-[18-[(2S,3R,5R)-2,3-dimethyl-5-(2-oxopropyl)oxolan-2-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-3,5,7,9,11,13,15-heptaen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)C[C@H]1C[C@@H](C)[C@](C)(CC(=O)C(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C#CC2=C(C)C[C@@H](OC(C)=O)CC2(C)C)O1 |
| InChI | InChI=1S/C42H56O5/c1-29(18-14-19-31(3)22-23-39-33(5)24-38(46-36(8)44)27-41(39,9)10)16-12-13-17-30(2)20-15-21-32(4)40(45)28-42(11)34(6)25-37(47-42)26-35(7)43/h12-21,34,37-38H,24-28H2,1-11H3/t34-,37-,38-,42+/m1/s1 |
| InChIKey | MWUUKEUNFHLTHL-TXZXUUBGSA-N |
| XLogP | 9.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|