C44H58O6 — CID 132993915
[4-[18-(4-acetyloxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,3-dimethyl-5-methylidenecyclohexyl] acetate (PubChem CID 132993915) has the molecular formula C44H58O6 and a molecular weight of 682.94 g/mol. Its IUPAC name is [4-[18-(4-acetyloxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,3-dimethyl-5-methylidenecyclohexyl] acetate.
| Compound Name | [4-[18-(4-acetyloxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,3-dimethyl-5-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 132993915 |
| Molecular Formula | C44H58O6 |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 682.42 |
| IUPAC Name | [4-[18-(4-acetyloxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,3-dimethyl-5-methylidenecyclohexyl] acetate |
| SMILES | C=C1CC(OC(C)=O)CC(C)(C)C1=C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C(=O)CC12OC1(C)CC(OC(C)=O)CC2(C)C |
| InChI | InChI=1S/C44H58O6/c1-30(19-15-20-32(3)23-24-39-34(5)25-37(48-35(6)45)26-41(39,8)9)17-13-14-18-31(2)21-16-22-33(4)40(47)29-44-42(10,11)27-38(49-36(7)46)28-43(44,12)50-44/h13-23,37-38H,5,25-29H2,1-4,6-12H3 |
| InChIKey | FGAMQNGFFIKHJD-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|