C41H52O — CID 162933515
1-[(1E,3E,5E,7E,9E,11E,13E,15E)-18-[(4R)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15-octaen-17-ynyl]-2,3,4-trimethylbenzene (PubChem CID 162933515) has the molecular formula C41H52O and a molecular weight of 560.87 g/mol. Its IUPAC name is 1-[(1E,3E,5E,7E,9E,11E,13E,15E)-18-[(4R)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15-octaen-17-ynyl]-2,3,4-trimethylbenzene.
| Compound Name | 1-[(1E,3E,5E,7E,9E,11E,13E,15E)-18-[(4R)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15-octaen-17-ynyl]-2,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 162933515 |
| Molecular Formula | C41H52O |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | 1-[(1E,3E,5E,7E,9E,11E,13E,15E)-18-[(4R)-4-methoxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15-octaen-17-ynyl]-2,3,4-trimethylbenzene |
| SMILES | CO[C@@H]1CC(C)=C(C#C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/c2ccc(C)c(C)c2C)C(C)(C)C1 |
| InChI | InChI=1S/C41H52O/c1-30(18-14-20-32(3)22-25-38-26-24-34(5)36(7)37(38)8)16-12-13-17-31(2)19-15-21-33(4)23-27-40-35(6)28-39(42-11)29-41(40,9)10/h12-22,24-26,39H,28-29H2,1-11H3/b13-12+,18-14+,19-15+,25-22+,30-16+,31-17+,32-20+,33-21+/t39-/m1/s1 |
| InChIKey | JXAMSIPPOCFEQO-JUSPVNCDSA-N |
| XLogP | 11.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|