C28H31BrO4 — CID 11849286
[(1R)-4-[(3Z,5E,7E,9E,11Z)-11-(4-bromo-5-oxofuran-2-ylidene)-3,10-dimethylundeca-3,5,7,9-tetraen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate (PubChem CID 11849286) has the molecular formula C28H31BrO4 and a molecular weight of 511.46 g/mol. Its IUPAC name is [(1R)-4-[(3Z,5E,7E,9E,11Z)-11-(4-bromo-5-oxofuran-2-ylidene)-3,10-dimethylundeca-3,5,7,9-tetraen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R)-4-[(3Z,5E,7E,9E,11Z)-11-(4-bromo-5-oxofuran-2-ylidene)-3,10-dimethylundeca-3,5,7,9-tetraen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 11849286 |
| Molecular Formula | C28H31BrO4 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | [(1R)-4-[(3Z,5E,7E,9E,11Z)-11-(4-bromo-5-oxofuran-2-ylidene)-3,10-dimethylundeca-3,5,7,9-tetraen-1-ynyl]-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C)=C(C#C/C(C)=C\C=C\C=C\C=C(C)\C=C2\C=C(Br)C(=O)O2)C(C)(C)C1 |
| InChI | InChI=1S/C28H31BrO4/c1-19(13-14-25-21(3)16-24(32-22(4)30)18-28(25,5)6)11-9-7-8-10-12-20(2)15-23-17-26(29)27(31)33-23/h7-12,15,17,24H,16,18H2,1-6H3/b9-7+,10-8+,19-11-,20-12+,23-15-/t24-/m1/s1 |
| InChIKey | NHGZHRHPTUMINL-HOKWKEEPSA-N |
| XLogP | 6.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|