C32H48O7 — CID 162933954
[(1S,2S,6R,10S,11R,13S,14R,15S)-14-acetyloxy-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate (PubChem CID 162933954) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is [(1S,2S,6R,10S,11R,13S,14R,15S)-14-acetyloxy-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate.
| Compound Name | [(1S,2S,6R,10S,11R,13S,14R,15S)-14-acetyloxy-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate |
|---|---|
| PubChem CID | 162933954 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | [(1S,2S,6R,10S,11R,13S,14R,15S)-14-acetyloxy-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@]12[C@H](OC(C)=O)[C@@H](C)[C@@H]3[C@@H](C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@H]34)[C@@H]1C2(C)C |
| InChI | InChI=1S/C32H48O7/c1-7-8-9-10-11-12-13-14-25(35)39-32-27(30(32,5)6)23-16-22(18-33)17-31(37)24(15-19(2)28(31)36)26(23)20(3)29(32)38-21(4)34/h15-16,20,23-24,26-27,29,33,37H,7-14,17-18H2,1-6H3/t20-,23+,24+,26+,27+,29+,31+,32+/m0/s1 |
| InChIKey | FWDRZTOWOFCZKS-LXKDZQMESA-N |
| XLogP | 5.08 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|