C14H20O5 — CID 162933959
10,11-dihydroxy-6-(hydroxymethyl)-3-methyl-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one (PubChem CID 162933959) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 10,11-dihydroxy-6-(hydroxymethyl)-3-methyl-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one.
| Compound Name | 10,11-dihydroxy-6-(hydroxymethyl)-3-methyl-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 162933959 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 10,11-dihydroxy-6-(hydroxymethyl)-3-methyl-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| SMILES | CC1C(=O)OC2C(O)C(O)=CCCC(CO)=CCC12 |
| InChI | InChI=1S/C14H20O5/c1-8-10-6-5-9(7-15)3-2-4-11(16)12(17)13(10)19-14(8)18/h4-5,8,10,12-13,15-17H,2-3,6-7H2,1H3 |
| InChIKey | YAYGKAJVKHRXPC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|