C16H26O2 — CID 162934948
(2S,2'R,3aR,7aS)-2'-methoxy-3,3,6-trimethylspiro[3a,4,5,7a-tetrahydro-1H-indene-2,3'-oxolane] (PubChem CID 162934948) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (2S,2'R,3aR,7aS)-2'-methoxy-3,3,6-trimethylspiro[3a,4,5,7a-tetrahydro-1H-indene-2,3'-oxolane].
| Compound Name | (2S,2'R,3aR,7aS)-2'-methoxy-3,3,6-trimethylspiro[3a,4,5,7a-tetrahydro-1H-indene-2,3'-oxolane] |
|---|---|
| PubChem CID | 162934948 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (2S,2'R,3aR,7aS)-2'-methoxy-3,3,6-trimethylspiro[3a,4,5,7a-tetrahydro-1H-indene-2,3'-oxolane] |
| SMILES | CO[C@@H]1OCC[C@]12C[C@H]1C=C(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C16H26O2/c1-11-5-6-13-12(9-11)10-16(15(13,2)3)7-8-18-14(16)17-4/h9,12-14H,5-8,10H2,1-4H3/t12-,13-,14-,16+/m1/s1 |
| InChIKey | HFFKWZFCUVOVOT-KQTLUZQSSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|