C16H24O2 — CID 162994506
(2R,3S,3'aR,7'aS)-2-methoxy-3',3',6'-trimethylspiro[2H-furan-3,2'-3a,4,5,7a-tetrahydro-1H-indene] (PubChem CID 162994506) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2R,3S,3'aR,7'aS)-2-methoxy-3',3',6'-trimethylspiro[2H-furan-3,2'-3a,4,5,7a-tetrahydro-1H-indene].
| Compound Name | (2R,3S,3'aR,7'aS)-2-methoxy-3',3',6'-trimethylspiro[2H-furan-3,2'-3a,4,5,7a-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 162994506 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2R,3S,3'aR,7'aS)-2-methoxy-3',3',6'-trimethylspiro[2H-furan-3,2'-3a,4,5,7a-tetrahydro-1H-indene] |
| SMILES | CO[C@@H]1OC=C[C@]12C[C@H]1C=C(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C16H24O2/c1-11-5-6-13-12(9-11)10-16(15(13,2)3)7-8-18-14(16)17-4/h7-9,12-14H,5-6,10H2,1-4H3/t12-,13-,14-,16+/m1/s1 |
| InChIKey | DUYMBGQPXANRME-KQTLUZQSSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|