C16H22O5 — CID 163112466
(6'-hydroperoxy-3',3'-dimethylspiro[2H-furan-3,2'-3a,4,5,6-tetrahydro-1H-indene]-2-yl) acetate (PubChem CID 163112466) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (6'-hydroperoxy-3',3'-dimethylspiro[2H-furan-3,2'-3a,4,5,6-tetrahydro-1H-indene]-2-yl) acetate.
| Compound Name | (6'-hydroperoxy-3',3'-dimethylspiro[2H-furan-3,2'-3a,4,5,6-tetrahydro-1H-indene]-2-yl) acetate |
|---|---|
| PubChem CID | 163112466 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (6'-hydroperoxy-3',3'-dimethylspiro[2H-furan-3,2'-3a,4,5,6-tetrahydro-1H-indene]-2-yl) acetate |
| SMILES | CC(=O)OC1OC=CC12CC1=CC(OO)CCC1C2(C)C |
| InChI | InChI=1S/C16H22O5/c1-10(17)20-14-16(6-7-19-14)9-11-8-12(21-18)4-5-13(11)15(16,2)3/h6-8,12-14,18H,4-5,9H2,1-3H3 |
| InChIKey | PXCWZNWKOPOIHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|