C23H22O6 — CID 162936254
10-hydroxy-7-(2-hydroxypropan-2-yl)-17,17-dimethyl-2,6,18-trioxapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-1(13),3,5(9),10,14(19),15,20-heptaen-12-one (PubChem CID 162936254) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 10-hydroxy-7-(2-hydroxypropan-2-yl)-17,17-dimethyl-2,6,18-trioxapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-1(13),3,5(9),10,14(19),15,20-heptaen-12-one.
| Compound Name | 10-hydroxy-7-(2-hydroxypropan-2-yl)-17,17-dimethyl-2,6,18-trioxapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-1(13),3,5(9),10,14(19),15,20-heptaen-12-one |
|---|---|
| PubChem CID | 162936254 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 10-hydroxy-7-(2-hydroxypropan-2-yl)-17,17-dimethyl-2,6,18-trioxapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-1(13),3,5(9),10,14(19),15,20-heptaen-12-one |
| SMILES | CC1(C)C=Cc2c(ccc3oc4cc5c(c(O)c4c(=O)c23)CC(C(C)(C)O)O5)O1 |
| InChI | InChI=1S/C23H22O6/c1-22(2)8-7-11-13(29-22)5-6-14-18(11)21(25)19-16(27-14)10-15-12(20(19)24)9-17(28-15)23(3,4)26/h5-8,10,17,24,26H,9H2,1-4H3 |
| InChIKey | XSIMSXOSXLZQRA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|