C22H30O5 — CID 162936743
methyl (1E,3Z,6R,7R)-6-[2-[(2S)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylate (PubChem CID 162936743) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (1E,3Z,6R,7R)-6-[2-[(2S)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylate.
| Compound Name | methyl (1E,3Z,6R,7R)-6-[2-[(2S)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 162936743 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (1E,3Z,6R,7R)-6-[2-[(2S)-2-methoxy-5-oxo-2H-furan-4-yl]ethyl]-6,7-dimethyl-10-methylidenecyclodeca-1,3-diene-1-carboxylate |
| SMILES | C=C1CC[C@@H](C)[C@](C)(CCC2=C[C@@H](OC)OC2=O)C/C=C\C=C/1C(=O)OC |
| InChI | InChI=1S/C22H30O5/c1-15-9-10-16(2)22(3,12-7-6-8-18(15)21(24)26-5)13-11-17-14-19(25-4)27-20(17)23/h6-8,14,16,19H,1,9-13H2,2-5H3/b7-6-,18-8+/t16-,19+,22+/m1/s1 |
| InChIKey | WKBFUNWYGOKFCQ-FQGPDSNVSA-N |
| XLogP | 4.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |