C27H36O5 — CID 162936846
16-hydroxy-5-(1-hydroxy-2-methylidenepent-3-enyl)-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),5-diene-4,7-dione (PubChem CID 162936846) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is 16-hydroxy-5-(1-hydroxy-2-methylidenepent-3-enyl)-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),5-diene-4,7-dione.
| Compound Name | 16-hydroxy-5-(1-hydroxy-2-methylidenepent-3-enyl)-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),5-diene-4,7-dione |
|---|---|
| PubChem CID | 162936846 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 16-hydroxy-5-(1-hydroxy-2-methylidenepent-3-enyl)-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),5-diene-4,7-dione |
| SMILES | C=C(C=CC)C(O)C1=CC(=O)C2=C(OC34CCC(O)C(C)(C)C3CCC(C)C4(C)C2)C1=O |
| InChI | InChI=1S/C27H36O5/c1-7-8-15(2)22(30)17-13-19(28)18-14-26(6)16(3)9-10-20-25(4,5)21(29)11-12-27(20,26)32-24(18)23(17)31/h7-8,13,16,20-22,29-30H,2,9-12,14H2,1,3-6H3 |
| InChIKey | KCQFTYLKISEUKX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|