C30H37NO5 — CID 86753791
(1S,13R,14S,17S,19S)-5,19-dihydroxy-13,14,18,18-tetramethyl-10-phenylmethoxy-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one (PubChem CID 86753791) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is (1S,13R,14S,17S,19S)-5,19-dihydroxy-13,14,18,18-tetramethyl-10-phenylmethoxy-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one.
| Compound Name | (1S,13R,14S,17S,19S)-5,19-dihydroxy-13,14,18,18-tetramethyl-10-phenylmethoxy-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
|---|---|
| PubChem CID | 86753791 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (1S,13R,14S,17S,19S)-5,19-dihydroxy-13,14,18,18-tetramethyl-10-phenylmethoxy-2-oxa-6-azapentacyclo[11.8.0.01,17.03,11.04,8]henicosa-3,8,10-trien-7-one |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)[C@@H](O)CC[C@]23Oc2c(c(OCc4ccccc4)cc4c2C(O)NC4=O)C[C@]13C |
| InChI | InChI=1S/C30H37NO5/c1-17-10-11-22-28(2,3)23(32)12-13-30(22)29(17,4)15-20-21(35-16-18-8-6-5-7-9-18)14-19-24(25(20)36-30)27(34)31-26(19)33/h5-9,14,17,22-23,27,32,34H,10-13,15-16H2,1-4H3,(H,31,33)/t17-,22-,23-,27?,29+,30-/m0/s1 |
| InChIKey | ZVHGGAMTCSQQLH-DTXXIJLNSA-N |
| XLogP | 4.91 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |