C16H14O4 — CID 163961951
4-hydroxy-5-methyl-6-phenylmethoxy-3H-2-benzofuran-1-one (PubChem CID 163961951) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-6-phenylmethoxy-3H-2-benzofuran-1-one.
| Compound Name | 4-hydroxy-5-methyl-6-phenylmethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163961951 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-hydroxy-5-methyl-6-phenylmethoxy-3H-2-benzofuran-1-one |
| SMILES | Cc1c(OCc2ccccc2)cc2c(c1O)COC2=O |
| InChI | InChI=1S/C16H14O4/c1-10-14(19-8-11-5-3-2-4-6-11)7-12-13(15(10)17)9-20-16(12)18/h2-7,17H,8-9H2,1H3 |
| InChIKey | SIHAPODWIDTYFU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |